| Pharmaceutical Information |
| Drug Name |
Terazosin hydrochloride |
| Drug ID |
BADD_D02159 |
| Description |
Terazosin is a quinazoline derivative alpha-1-selective adrenergic blocking agent indicated for benign prostatic hyperplasia and hypertension[FDA Label][A176831]. Terazosin blocks adrenaline's action on alpha-1 adrenergic receptors, causing relaxation of smooth muscle in blood vessels and the prostate[A176837]. |
| Indications and Usage |
Terazosin is indicated for use in treating symptomatic benign prostatic hyperplasia and hypertension[FDA Label]. |
| Marketing Status |
approved |
| ATC Code |
G04CA03 |
| DrugBank ID |
DB01162
|
| KEGG ID |
D00610
|
| MeSH ID |
C041226
|
| PubChem ID |
44383
|
| TTD Drug ID |
D0P9RF
|
| NDC Product Code |
50090-2371; 51407-733; 51407-735; 53002-1726; 63629-2439; 71610-698; 65372-1127; 65862-205; 42291-820; 42291-822; 53002-1727; 63187-620; 66267-325; 71610-503; 71610-715; 50268-765; 50268-766; 53002-1728; 60760-316; 68788-9817; 71610-594; 71610-720; 50090-0657; 51407-734; 53002-1250; 68788-9816; 24689-792; 24689-961; 51407-732; 59746-384; 63629-5237; 71335-2125; 71610-595; 63415-0116; 49999-227; 50090-1559; 50268-764; 42291-823; 59746-386; 63187-456; 71610-478; 71610-510; 42291-821; 50268-767; 68788-9815; 70518-3114; 73435-029; 24689-855; 24689-882; 50090-2623; 55700-750; 59746-383; 59746-385 |
| UNII |
D32S14F082
|
| Synonyms |
Terazosin | Adecur | Apo-Terazosin | Dysalfa | Hytrin | Flotrin | Hytrin BPH | Hytrine | Heitrin | Deflox | Magnurol | Novo-Terazosin | Nu-Terazosin | PMS-Terazosin | terazosin hydrochloride anhydrous | Sutif | Tazusin | Terazoflo | Terazosin AZU | Terazosin Hexal | Terazosin hydrochloride | terazosin, monohydrochloride, dihydrate | Terazosina Alter | Terazosina Kern | Terazosina Qualix | Zayasel | A 45975 | ratio-Terazosin |
|
| Chemical Information |
| Molecular Formula |
C19H26ClN5O4 |
| CAS Registry Number |
63074-08-8 |
| SMILES |
COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCN(CC3)C(=O)C4CCCO4)N)OC.Cl |
| Chemical Structure |
|
|
| ADRs Induced by Drug |
|
|
*The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice..
|
|
|
